C23H28INO5 — CID 10324543
2-[(1R,2R,7S,9S)-8-methyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecan-8-yl]ethanol iodide (PubChem CID 10324543) has the molecular formula C23H28INO5 and a molecular weight of 525.38 g/mol. Its IUPAC name is 2-[(1R,2R,7S,9S)-8-methyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecan-8-yl]ethanol iodide.
| Compound Name | 2-[(1R,2R,7S,9S)-8-methyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecan-8-yl]ethanol iodide |
|---|---|
| PubChem CID | 10324543 |
| Molecular Formula | C23H28INO5 |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 2-[(1R,2R,7S,9S)-8-methyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecan-8-yl]ethanol iodide |
| SMILES | C[N+]1(CCO)[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21.[I-] |
| InChI | InChI=1S/C23H28NO5.HI/c1-24(12-13-25)18-14-26-22(16-8-4-2-5-9-16)28-20(18)21-19(24)15-27-23(29-21)17-10-6-3-7-11-17;/h2-11,18-23,25H,12-15H2,1H3;1H/q+1;/p-1/t18-,19-,20+,21+,22?,23?,24?;/m0./s1 |
| InChIKey | XIHRLMMGRQVFTL-SONVADGDSA-M |
| XLogP | -0.59 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|