C11H12FNO3 — CID 103245520
2-[(4-fluoro-2-methoxyanilino)methyl]prop-2-enoic acid (PubChem CID 103245520) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-[(4-fluoro-2-methoxyanilino)methyl]prop-2-enoic acid.
| Compound Name | 2-[(4-fluoro-2-methoxyanilino)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103245520 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[(4-fluoro-2-methoxyanilino)methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1ccc(F)cc1OC)C(=O)O |
| InChI | InChI=1S/C11H12FNO3/c1-7(11(14)15)6-13-9-4-3-8(12)5-10(9)16-2/h3-5,13H,1,6H2,2H3,(H,14,15) |
| InChIKey | ODAVZDXVBYOYMC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|