C10H19NO3 — CID 103245626
2-[(3-methoxy-2-methylpropyl)amino]cyclobutane-1-carboxylic acid (PubChem CID 103245626) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[(3-methoxy-2-methylpropyl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[(3-methoxy-2-methylpropyl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 103245626 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-[(3-methoxy-2-methylpropyl)amino]cyclobutane-1-carboxylic acid |
| SMILES | COCC(C)CNC1CCC1C(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-7(6-14-2)5-11-9-4-3-8(9)10(12)13/h7-9,11H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | NHSVPGZCKCFJOE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |