C33H41N3O3 — CID 10324628
N-[3-[1-[3-[(2-hydroxy-2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-4-methylphenyl]-2-methylpropanamide (PubChem CID 10324628) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[3-[1-[3-[(2-hydroxy-2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-4-methylphenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[3-[(2-hydroxy-2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-4-methylphenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 10324628 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | N-[3-[1-[3-[(2-hydroxy-2,2-diphenylacetyl)amino]propyl]piperidin-4-yl]-4-methylphenyl]-2-methylpropanamide |
| SMILES | Cc1ccc(NC(=O)C(C)C)cc1C1CCN(CCCNC(=O)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H41N3O3/c1-24(2)31(37)35-29-16-15-25(3)30(23-29)26-17-21-36(22-18-26)20-10-19-34-32(38)33(39,27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-9,11-16,23-24,26,39H,10,17-22H2,1-3H3,(H,34,38)(H,35,37) |
| InChIKey | INMZLZRTJQLJQQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|