C12H9ClFNO2S — CID 103247413
3-[(4-chloro-2-fluoroanilino)methyl]thiophene-2-carboxylic acid (PubChem CID 103247413) has the molecular formula C12H9ClFNO2S and a molecular weight of 285.73 g/mol. Its IUPAC name is 3-[(4-chloro-2-fluoroanilino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(4-chloro-2-fluoroanilino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103247413 |
| Molecular Formula | C12H9ClFNO2S |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-[(4-chloro-2-fluoroanilino)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1CNc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H9ClFNO2S/c13-8-1-2-10(9(14)5-8)15-6-7-3-4-18-11(7)12(16)17/h1-5,15H,6H2,(H,16,17) |
| InChIKey | OTMVNASLWLZEEM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |