C11H21N3O — CID 103247876
2-amino-3-[2-(cyclohexen-1-yl)ethylamino]propanamide (PubChem CID 103247876) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-amino-3-[2-(cyclohexen-1-yl)ethylamino]propanamide.
| Compound Name | 2-amino-3-[2-(cyclohexen-1-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 103247876 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2-amino-3-[2-(cyclohexen-1-yl)ethylamino]propanamide |
| SMILES | NC(=O)C(N)CNCCC1=CCCCC1 |
| InChI | InChI=1S/C11H21N3O/c12-10(11(13)15)8-14-7-6-9-4-2-1-3-5-9/h4,10,14H,1-3,5-8,12H2,(H2,13,15) |
| InChIKey | NGQIRSNATADCJB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|