C13H15FN2O2 — CID 103247911
2-(3-cyano-4-fluoroanilino)hexanoic acid (PubChem CID 103247911) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-(3-cyano-4-fluoroanilino)hexanoic acid.
| Compound Name | 2-(3-cyano-4-fluoroanilino)hexanoic acid |
|---|---|
| PubChem CID | 103247911 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(3-cyano-4-fluoroanilino)hexanoic acid |
| SMILES | CCCCC(Nc1ccc(F)c(C#N)c1)C(=O)O |
| InChI | InChI=1S/C13H15FN2O2/c1-2-3-4-12(13(17)18)16-10-5-6-11(14)9(7-10)8-15/h5-7,12,16H,2-4H2,1H3,(H,17,18) |
| InChIKey | BUOCLIUFPHTHSE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |