C11H20N2O4 — CID 103248566
ethyl 3-hydroxy-4-[(2-oxopiperidin-3-yl)amino]butanoate (PubChem CID 103248566) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-[(2-oxopiperidin-3-yl)amino]butanoate.
| Compound Name | ethyl 3-hydroxy-4-[(2-oxopiperidin-3-yl)amino]butanoate |
|---|---|
| PubChem CID | 103248566 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | ethyl 3-hydroxy-4-[(2-oxopiperidin-3-yl)amino]butanoate |
| SMILES | CCOC(=O)CC(O)CNC1CCCNC1=O |
| InChI | InChI=1S/C11H20N2O4/c1-2-17-10(15)6-8(14)7-13-9-4-3-5-12-11(9)16/h8-9,13-14H,2-7H2,1H3,(H,12,16) |
| InChIKey | DPDXEIQSDQSTGE-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |