About (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid
(E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid (PubChem CID 103248630) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid |
| PubChem CID | 103248630 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid |
| SMILES | Cn1cnnc1CNC/C=C/C(=O)O |
| InChI | InChI=1S/C8H12N4O2/c1-12-6-10-11-7(12)5-9-4-2-3-8(13)14/h2-3,6,9H,4-5H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | BNFMIBSLLVZQAK-NSCUHMNNSA-N |
| XLogP | -0.45 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
The IUPAC name of (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid (CID 103248630) is (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid.
What is the SMILES notation for (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
The canonical SMILES for (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid is Cn1cnnc1CNC/C=C/C(=O)O.
What is the InChIKey of (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
The InChIKey is BNFMIBSLLVZQAK-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H12N4O2/c1-12-6-10-11-7(12)5-9-4-2-3-8(13)14/h2-3,6,9H,4-5H2,1H3,(H,13,14)/b3-2+.
What are the key properties of (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
(E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid has a molecular weight of 196.21 g/mol, XLogP of -0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid is sourced from PubChem (CID 103248630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).