About 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid
2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid (PubChem CID 103248638) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid.
Molecular Properties
| Compound Name | 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid |
| PubChem CID | 103248638 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid |
| SMILES | CCC(=CCNCc1nncn1C)C(=O)O |
| InChI | InChI=1S/C10H16N4O2/c1-3-8(10(15)16)4-5-11-6-9-13-12-7-14(9)2/h4,7,11H,3,5-6H2,1-2H3,(H,15,16) |
| InChIKey | VAQMFXQAWJJPJD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
The IUPAC name of 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid (CID 103248638) is 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid.
What is the SMILES notation for 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
The canonical SMILES for 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid is CCC(=CCNCc1nncn1C)C(=O)O.
What is the InChIKey of 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
The InChIKey is VAQMFXQAWJJPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c1-3-8(10(15)16)4-5-11-6-9-13-12-7-14(9)2/h4,7,11H,3,5-6H2,1-2H3,(H,15,16).
What are the key properties of 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid?
2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid has a molecular weight of 224.26 g/mol, XLogP of 0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]but-2-enoic acid is sourced from PubChem (CID 103248638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).