C10H16N4O2 — CID 103248662
(Z)-2-methyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoic acid (PubChem CID 103248662) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is (Z)-2-methyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoic acid.
| Compound Name | (Z)-2-methyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103248662 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (Z)-2-methyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoic acid |
| SMILES | C/C(=C/CNC(C)c1nncn1C)C(=O)O |
| InChI | InChI=1S/C10H16N4O2/c1-7(10(15)16)4-5-11-8(2)9-13-12-6-14(9)3/h4,6,8,11H,5H2,1-3H3,(H,15,16)/b7-4- |
| InChIKey | SSBPEBAHCDUKOI-DAXSKMNVSA-N |
| XLogP | 0.50 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|