About methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate
methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate (PubChem CID 103248675) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate |
| PubChem CID | 103248675 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate |
| SMILES | CCC(=CCNC(C)c1nncn1C)C(=O)OC |
| InChI | InChI=1S/C12H20N4O2/c1-5-10(12(17)18-4)6-7-13-9(2)11-15-14-8-16(11)3/h6,8-9,13H,5,7H2,1-4H3 |
| InChIKey | NDGPELOXEJBYTG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate (CID 103248675) is methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate is CCC(=CCNC(C)c1nncn1C)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate?
The InChIKey is NDGPELOXEJBYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-5-10(12(17)18-4)6-7-13-9(2)11-15-14-8-16(11)3/h6,8-9,13H,5,7H2,1-4H3.
What are the key properties of methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate?
methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate has a molecular weight of 252.32 g/mol, XLogP of 0.98, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]but-2-enoate is sourced from PubChem (CID 103248675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).