C26H34F6N2O3 — CID 10324891
[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-[(1S,3R)-3-(oxan-4-ylamino)-1-propan-2-ylcyclopentyl]methanone (PubChem CID 10324891) has the molecular formula C26H34F6N2O3 and a molecular weight of 536.56 g/mol. Its IUPAC name is [7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-[(1S,3R)-3-(oxan-4-ylamino)-1-propan-2-ylcyclopentyl]methanone.
| Compound Name | [7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-[(1S,3R)-3-(oxan-4-ylamino)-1-propan-2-ylcyclopentyl]methanone |
|---|---|
| PubChem CID | 10324891 |
| Molecular Formula | C26H34F6N2O3 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-[(1S,3R)-3-(oxan-4-ylamino)-1-propan-2-ylcyclopentyl]methanone |
| SMILES | CC(C)[C@]1(C(=O)N2CCc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3C2)CC[C@@H](NC2CCOCC2)C1 |
| InChI | InChI=1S/C26H34F6N2O3/c1-16(2)23(9-5-21(14-23)33-20-7-11-37-12-8-20)22(35)34-10-6-17-3-4-19(13-18(17)15-34)24(36,25(27,28)29)26(30,31)32/h3-4,13,16,20-21,33,36H,5-12,14-15H2,1-2H3/t21-,23+/m1/s1 |
| InChIKey | QURGHLGZILZWLZ-GGAORHGYSA-N |
| XLogP | 4.85 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |