2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid

C14H10F3NO2 — CID 103249563

IUPAC2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid
SMILESO=C(O)C(Nc1cc(F)c(F)cc1F)c1ccccc1
InChIInChI=1S/C14H10F3NO2/c15-9-6-11(17)12(7-10(9)16)18-13(14(19)20)8-4-2-1-3-5-8/h1-7,13,18H,(H,19,20)
InChIKeyVIEQTLQGWHIEGY-UHFFFAOYSA-N
MW281.23 g/mol
LogP3.34
Rot. Bonds4

About 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid

2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid (PubChem CID 103249563) has the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. Its IUPAC name is 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid.

Molecular Properties

Compound Name2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid
PubChem CID103249563
Molecular FormulaC14H10F3NO2
Molecular Weight281.23 g/mol
Exact Mass281.07
IUPAC Name2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid
SMILESO=C(O)C(Nc1cc(F)c(F)cc1F)c1ccccc1
InChIInChI=1S/C14H10F3NO2/c15-9-6-11(17)12(7-10(9)16)18-13(14(19)20)8-4-2-1-3-5-8/h1-7,13,18H,(H,19,20)
InChIKeyVIEQTLQGWHIEGY-UHFFFAOYSA-N
XLogP3.34
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.23
LogP ≤ 53.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid?
The IUPAC name of 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid (CID 103249563) is 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid.
What is the SMILES notation for 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid?
The canonical SMILES for 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid is O=C(O)C(Nc1cc(F)c(F)cc1F)c1ccccc1.
What is the InChIKey of 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid?
The InChIKey is VIEQTLQGWHIEGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO2/c15-9-6-11(17)12(7-10(9)16)18-13(14(19)20)8-4-2-1-3-5-8/h1-7,13,18H,(H,19,20).
What are the key properties of 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid?
2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid has a molecular weight of 281.23 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-(2,4,5-trifluoroanilino)acetic acid is sourced from PubChem (CID 103249563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).