C8H16N6O — CID 103251288
2-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanamide (PubChem CID 103251288) has the molecular formula C8H16N6O and a molecular weight of 212.26 g/mol. Its IUPAC name is 2-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanamide.
| Compound Name | 2-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 103251288 |
| Molecular Formula | C8H16N6O |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propanamide |
| SMILES | Cn1cnnc1CCNCC(N)C(N)=O |
| InChI | InChI=1S/C8H16N6O/c1-14-5-12-13-7(14)2-3-11-4-6(9)8(10)15/h5-6,11H,2-4,9H2,1H3,(H2,10,15) |
| InChIKey | VTLCGXBSSGQUGO-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|