C26H33F2N7O4 — CID 10325135
3-piperidin-1-ylpropyl N-[4-[2,4-difluoro-5-(methoxycarbamoyl)anilino]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate (PubChem CID 10325135) has the molecular formula C26H33F2N7O4 and a molecular weight of 545.59 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl N-[4-[2,4-difluoro-5-(methoxycarbamoyl)anilino]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate.
| Compound Name | 3-piperidin-1-ylpropyl N-[4-[2,4-difluoro-5-(methoxycarbamoyl)anilino]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate |
|---|---|
| PubChem CID | 10325135 |
| Molecular Formula | C26H33F2N7O4 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 3-piperidin-1-ylpropyl N-[4-[2,4-difluoro-5-(methoxycarbamoyl)anilino]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamate |
| SMILES | CONC(=O)c1cc(Nc2ncnn3cc(NC(=O)OCCCN4CCCCC4)c(C(C)C)c23)c(F)cc1F |
| InChI | InChI=1S/C26H33F2N7O4/c1-16(2)22-21(32-26(37)39-11-7-10-34-8-5-4-6-9-34)14-35-23(22)24(29-15-30-35)31-20-12-17(25(36)33-38-3)18(27)13-19(20)28/h12-16H,4-11H2,1-3H3,(H,32,37)(H,33,36)(H,29,30,31) |
| InChIKey | LMHPBVGQEGWFGF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|