C32H38N2O6 — CID 10325162
[1-acetyloxy-10-hydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate (PubChem CID 10325162) has the molecular formula C32H38N2O6 and a molecular weight of 546.66 g/mol. Its IUPAC name is [1-acetyloxy-10-hydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate.
| Compound Name | [1-acetyloxy-10-hydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate |
|---|---|
| PubChem CID | 10325162 |
| Molecular Formula | C32H38N2O6 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | [1-acetyloxy-10-hydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c2c(c1)N(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)c1cccc(O)c1N2 |
| InChI | InChI=1S/C32H38N2O6/c1-20(2)10-7-11-21(3)12-8-13-22(4)16-17-34-27-18-25(39-23(5)35)19-29(40-24(6)36)31(27)33-30-26(32(34)38)14-9-15-28(30)37/h9-10,12,14-16,18-19,33,37H,7-8,11,13,17H2,1-6H3/b21-12+,22-16+ |
| InChIKey | ZYMKOQJHSTUSPB-PMPJFHHKSA-N |
| XLogP | 7.37 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|