About (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid
(E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid (PubChem CID 103251715) has the molecular formula C7H10F3NO3
and a molecular weight of 213.15 g/mol. Its IUPAC name is (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid |
| PubChem CID | 103251715 |
| Molecular Formula | C7H10F3NO3 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/NCCOCC(F)(F)F |
| InChI | InChI=1S/C7H10F3NO3/c8-7(9,10)5-14-4-3-11-2-1-6(12)13/h1-2,11H,3-5H2,(H,12,13)/b2-1+ |
| InChIKey | ANIFUBGAMSLSGT-OWOJBTEDSA-N |
| XLogP | 0.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid?
The IUPAC name of (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid (CID 103251715) is (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid?
The canonical SMILES for (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid is O=C(O)/C=C/NCCOCC(F)(F)F.
What is the InChIKey of (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid?
The InChIKey is ANIFUBGAMSLSGT-OWOJBTEDSA-N. The full InChI is InChI=1S/C7H10F3NO3/c8-7(9,10)5-14-4-3-11-2-1-6(12)13/h1-2,11H,3-5H2,(H,12,13)/b2-1+.
What are the key properties of (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid?
(E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid has a molecular weight of 213.15 g/mol, XLogP of 0.75, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]prop-2-enoic acid is sourced from PubChem (CID 103251715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).