C10H20N2O2 — CID 103251923
2-amino-3-(1-cyclopentylethylamino)propanoic acid (PubChem CID 103251923) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-amino-3-(1-cyclopentylethylamino)propanoic acid.
| Compound Name | 2-amino-3-(1-cyclopentylethylamino)propanoic acid |
|---|---|
| PubChem CID | 103251923 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-amino-3-(1-cyclopentylethylamino)propanoic acid |
| SMILES | CC(NCC(N)C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-7(8-4-2-3-5-8)12-6-9(11)10(13)14/h7-9,12H,2-6,11H2,1H3,(H,13,14) |
| InChIKey | XLPJAZPGJYTSDB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |