C33H43NO6 — CID 10325243
5-((2R,3R,4S,5R,6R)-3,4,5-Tris-benzyloxy-6-methoxy-tetrahydro-pyran-2-ylmethoxy)-pentylamine (PubChem CID 10325243) has the molecular formula C33H43NO6 and a molecular weight of 549.70 g/mol. Its IUPAC name is 5-[[(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]pentan-1-amine.
| Compound Name | 5-((2R,3R,4S,5R,6R)-3,4,5-Tris-benzyloxy-6-methoxy-tetrahydro-pyran-2-ylmethoxy)-pentylamine |
|---|---|
| PubChem CID | 10325243 |
| Molecular Formula | C33H43NO6 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 5-[[(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]pentan-1-amine |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COCCCCCN)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
| InChI | InChI=1S/C33H43NO6/c1-35-33-32(39-24-28-18-10-4-11-19-28)31(38-23-27-16-8-3-9-17-27)30(37-22-26-14-6-2-7-15-26)29(40-33)25-36-21-13-5-12-20-34/h2-4,6-11,14-19,29-33H,5,12-13,20-25,34H2,1H3/t29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | AFZZYNSWDWCNIN-IZDBAANZSA-N |
| XLogP | 4.20 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | 634 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|