C11H11BrF3NO3 — CID 103252455
4-[3-bromo-5-(trifluoromethyl)anilino]-3-hydroxybutanoic acid (PubChem CID 103252455) has the molecular formula C11H11BrF3NO3 and a molecular weight of 342.11 g/mol. Its IUPAC name is 4-[3-bromo-5-(trifluoromethyl)anilino]-3-hydroxybutanoic acid.
| Compound Name | 4-[3-bromo-5-(trifluoromethyl)anilino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 103252455 |
| Molecular Formula | C11H11BrF3NO3 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 4-[3-bromo-5-(trifluoromethyl)anilino]-3-hydroxybutanoic acid |
| SMILES | O=C(O)CC(O)CNc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11BrF3NO3/c12-7-1-6(11(13,14)15)2-8(3-7)16-5-9(17)4-10(18)19/h1-3,9,16-17H,4-5H2,(H,18,19) |
| InChIKey | IEWUEBBNBATIJX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |