About methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate
methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate (PubChem CID 103252544) has the molecular formula C13H25N3O2
and a molecular weight of 255.36 g/mol. Its IUPAC name is methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate |
| PubChem CID | 103252544 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCNCC1CN(C)CCN1C |
| InChI | InChI=1S/C13H25N3O2/c1-11(13(17)18-4)5-6-14-9-12-10-15(2)7-8-16(12)3/h5,12,14H,6-10H2,1-4H3 |
| InChIKey | FRUGOYFPFCSKIB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate?
The IUPAC name of methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate (CID 103252544) is methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate.
What is the SMILES notation for methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate?
The canonical SMILES for methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate is COC(=O)C(C)=CCNCC1CN(C)CCN1C.
What is the InChIKey of methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate?
The InChIKey is FRUGOYFPFCSKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O2/c1-11(13(17)18-4)5-6-14-9-12-10-15(2)7-8-16(12)3/h5,12,14H,6-10H2,1-4H3.
What are the key properties of methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate?
methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate has a molecular weight of 255.36 g/mol, XLogP of -0.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate is sourced from PubChem (CID 103252544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).