C13H25N3O2 — CID 103252544
methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate (PubChem CID 103252544) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate.
| Compound Name | methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 103252544 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | methyl 4-[(1,4-dimethylpiperazin-2-yl)methylamino]-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCNCC1CN(C)CCN1C |
| InChI | InChI=1S/C13H25N3O2/c1-11(13(17)18-4)5-6-14-9-12-10-15(2)7-8-16(12)3/h5,12,14H,6-10H2,1-4H3 |
| InChIKey | FRUGOYFPFCSKIB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|