C10H6Cl2F3N3O2S — CID 103252566
2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 103252566) has the molecular formula C10H6Cl2F3N3O2S and a molecular weight of 360.14 g/mol. Its IUPAC name is 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 103252566 |
| Molecular Formula | C10H6Cl2F3N3O2S |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | O=C(O)C(CNc1c(Cl)cc(Cl)c2c1N=S=N2)C(F)(F)F |
| InChI | InChI=1S/C10H6Cl2F3N3O2S/c11-4-1-5(12)7-8(18-21-17-7)6(4)16-2-3(9(19)20)10(13,14)15/h1,3,16H,2H2,(H,19,20) |
| InChIKey | KEKLWEWQEVNPMV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |