C14H27NO4 — CID 103253206
ethyl 3-hydroxy-4-[(1-hydroxycycloheptyl)methylamino]butanoate (PubChem CID 103253206) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-[(1-hydroxycycloheptyl)methylamino]butanoate.
| Compound Name | ethyl 3-hydroxy-4-[(1-hydroxycycloheptyl)methylamino]butanoate |
|---|---|
| PubChem CID | 103253206 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethyl 3-hydroxy-4-[(1-hydroxycycloheptyl)methylamino]butanoate |
| SMILES | CCOC(=O)CC(O)CNCC1(O)CCCCCC1 |
| InChI | InChI=1S/C14H27NO4/c1-2-19-13(17)9-12(16)10-15-11-14(18)7-5-3-4-6-8-14/h12,15-16,18H,2-11H2,1H3 |
| InChIKey | ZENNSVDPYBPOFP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |