C12H21NO2 — CID 103253355
2-[[(3,4-dimethylcyclohexyl)amino]methyl]prop-2-enoic acid (PubChem CID 103253355) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[[(3,4-dimethylcyclohexyl)amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[(3,4-dimethylcyclohexyl)amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103253355 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[[(3,4-dimethylcyclohexyl)amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNC1CCC(C)C(C)C1)C(=O)O |
| InChI | InChI=1S/C12H21NO2/c1-8-4-5-11(6-9(8)2)13-7-10(3)12(14)15/h8-9,11,13H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | MIZKWUCWHBXHAF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|