C14H24N4O3 — CID 103253419
1-[2-[(4-ethyl-1-hydroxycyclohexyl)methylamino]ethyl]triazole-4-carboxylic acid (PubChem CID 103253419) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[2-[(4-ethyl-1-hydroxycyclohexyl)methylamino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(4-ethyl-1-hydroxycyclohexyl)methylamino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103253419 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-[2-[(4-ethyl-1-hydroxycyclohexyl)methylamino]ethyl]triazole-4-carboxylic acid |
| SMILES | CCC1CCC(O)(CNCCn2cc(C(=O)O)nn2)CC1 |
| InChI | InChI=1S/C14H24N4O3/c1-2-11-3-5-14(21,6-4-11)10-15-7-8-18-9-12(13(19)20)16-17-18/h9,11,15,21H,2-8,10H2,1H3,(H,19,20) |
| InChIKey | GPGNYLMVTQPMTF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|