C27H38O8S2 — CID 10325367
[4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyl-1-methylsulfonyloxyoct-5-enyl]-2,6-dimethylphenyl] methanesulfonate (PubChem CID 10325367) has the molecular formula C27H38O8S2 and a molecular weight of 554.73 g/mol. Its IUPAC name is [4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyl-1-methylsulfonyloxyoct-5-enyl]-2,6-dimethylphenyl] methanesulfonate.
| Compound Name | [4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyl-1-methylsulfonyloxyoct-5-enyl]-2,6-dimethylphenyl] methanesulfonate |
|---|---|
| PubChem CID | 10325367 |
| Molecular Formula | C27H38O8S2 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | [4-[(E)-8-(3,5-dimethoxyphenyl)-5-methyl-1-methylsulfonyloxyoct-5-enyl]-2,6-dimethylphenyl] methanesulfonate |
| SMILES | COc1cc(CC/C=C(\C)CCCC(OS(C)(=O)=O)c2cc(C)c(OS(C)(=O)=O)c(C)c2)cc(OC)c1 |
| InChI | InChI=1S/C27H38O8S2/c1-19(10-8-12-22-16-24(32-4)18-25(17-22)33-5)11-9-13-26(34-36(6,28)29)23-14-20(2)27(21(3)15-23)35-37(7,30)31/h10,14-18,26H,8-9,11-13H2,1-7H3/b19-10+ |
| InChIKey | ISEKVBALNMLKBS-VXLYETTFSA-N |
| XLogP | 5.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|