C29H52O8Si — CID 10325414
(2R,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoic acid (PubChem CID 10325414) has the molecular formula C29H52O8Si and a molecular weight of 556.81 g/mol. Its IUPAC name is (2R,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoic acid.
| Compound Name | (2R,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 10325414 |
| Molecular Formula | C29H52O8Si |
| Molecular Weight | 556.81 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | (2R,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoic acid |
| SMILES | COCCOCO[C@H]1CC[C@@H]2[C@H]1C=C[C@@H]([C@H](C(=O)O)[C@@H](C)CCC1OCCO1)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H52O8Si/c1-20(8-13-26-34-16-17-35-26)27(28(30)31)21-9-10-22-23(11-12-24(22)36-19-33-15-14-32-5)25(18-21)37-38(6,7)29(2,3)4/h9-10,20-27H,8,11-19H2,1-7H3,(H,30,31)/t20-,21+,22+,23+,24-,25-,27+/m0/s1 |
| InChIKey | LYZGVCMNRPHGTG-KPQZWGSWSA-N |
| XLogP | 5.47 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.81 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|