(E)-3-(3-hydroxybutylamino)prop-2-enoic acid

C7H13NO3 — CID 103254188

IUPAC(E)-3-(3-hydroxybutylamino)prop-2-enoic acid
SMILESCC(O)CCN/C=C/C(=O)O
InChIInChI=1S/C7H13NO3/c1-6(9)2-4-8-5-3-7(10)11/h3,5-6,8-9H,2,4H2,1H3,(H,10,11)/b5-3+
InChIKeyQSDCJQOHHMIHCN-HWKANZROSA-N
MW159.19 g/mol
LogP-0.05
Rot. Bonds5

About (E)-3-(3-hydroxybutylamino)prop-2-enoic acid

(E)-3-(3-hydroxybutylamino)prop-2-enoic acid (PubChem CID 103254188) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is (E)-3-(3-hydroxybutylamino)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3-hydroxybutylamino)prop-2-enoic acid
PubChem CID103254188
Molecular FormulaC7H13NO3
Molecular Weight159.19 g/mol
Exact Mass159.09
IUPAC Name(E)-3-(3-hydroxybutylamino)prop-2-enoic acid
SMILESCC(O)CCN/C=C/C(=O)O
InChIInChI=1S/C7H13NO3/c1-6(9)2-4-8-5-3-7(10)11/h3,5-6,8-9H,2,4H2,1H3,(H,10,11)/b5-3+
InChIKeyQSDCJQOHHMIHCN-HWKANZROSA-N
XLogP-0.05
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.19
LogP ≤ 5-0.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3-hydroxybutylamino)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(Butylamino)prop-2-enoic acid
CID 73762502
3-(Propylamino)prop-2-enoic acid
CID 87503886
(E)-3-(1-hydroxyethylamino)prop-2-enoic acid
CID 163482223
(E)-3-(butylamino)prop-2-enoic acid
CID 21292230
(E)-3-(3-ethoxypropylamino)prop-2-enoic acid
CID 103234676
(E)-3-(3-methoxypropylamino)prop-2-enoic acid
CID 103237164
(E)-3-(2-hydroxypropylamino)prop-2-enoic acid
CID 103238162
methyl (E)-3-(3-hydroxypropylamino)prop-2-enoate
CID 103238209
(E)-3-(3-hydroxypropylamino)prop-2-enoic acid
CID 103238214
(E)-3-[(2-hydroxy-3-methoxypropyl)amino]prop-2-enoic acid
CID 103253320
(E)-3-[(3-hydroxy-2-methylpropyl)amino]prop-2-enoic acid
CID 103253890
methyl (E)-3-(3-hydroxybutylamino)prop-2-enoate
CID 103254183

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3-hydroxybutylamino)prop-2-enoic acid?
The IUPAC name of (E)-3-(3-hydroxybutylamino)prop-2-enoic acid (CID 103254188) is (E)-3-(3-hydroxybutylamino)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(3-hydroxybutylamino)prop-2-enoic acid?
The canonical SMILES for (E)-3-(3-hydroxybutylamino)prop-2-enoic acid is CC(O)CCN/C=C/C(=O)O.
What is the InChIKey of (E)-3-(3-hydroxybutylamino)prop-2-enoic acid?
The InChIKey is QSDCJQOHHMIHCN-HWKANZROSA-N. The full InChI is InChI=1S/C7H13NO3/c1-6(9)2-4-8-5-3-7(10)11/h3,5-6,8-9H,2,4H2,1H3,(H,10,11)/b5-3+.
What are the key properties of (E)-3-(3-hydroxybutylamino)prop-2-enoic acid?
(E)-3-(3-hydroxybutylamino)prop-2-enoic acid has a molecular weight of 159.19 g/mol, XLogP of -0.05, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-hydroxybutylamino)prop-2-enoic acid is sourced from PubChem (CID 103254188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).