About bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate
bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate (PubChem CID 10325443) has the molecular formula C31H50O5Si2
and a molecular weight of 558.91 g/mol. Its IUPAC name is bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate.
Molecular Properties
| Compound Name | bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate |
| PubChem CID | 10325443 |
| Molecular Formula | C31H50O5Si2 |
| Molecular Weight | 558.91 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate |
| SMILES | Cc1cc(CO[Si](C)(C)C(C)(C)C)cc(C)c1OC(=O)Oc1c(C)cc(CO[Si](C)(C)C(C)(C)C)cc1C |
| InChI | InChI=1S/C31H50O5Si2/c1-21-15-25(19-33-37(11,12)30(5,6)7)16-22(2)27(21)35-29(32)36-28-23(3)17-26(18-24(28)4)20-34-38(13,14)31(8,9)10/h15-18H,19-20H2,1-14H3 |
| InChIKey | QZXFCASDCYMCBV-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.91 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate?
The IUPAC name of bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate (CID 10325443) is bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate.
What is the SMILES notation for bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate?
The canonical SMILES for bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate is Cc1cc(CO[Si](C)(C)C(C)(C)C)cc(C)c1OC(=O)Oc1c(C)cc(CO[Si](C)(C)C(C)(C)C)cc1C.
What is the InChIKey of bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate?
The InChIKey is QZXFCASDCYMCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H50O5Si2/c1-21-15-25(19-33-37(11,12)30(5,6)7)16-22(2)27(21)35-29(32)36-28-23(3)17-26(18-24(28)4)20-34-38(13,14)31(8,9)10/h15-18H,19-20H2,1-14H3.
What are the key properties of bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate?
bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate has a molecular weight of 558.91 g/mol, XLogP of 9.54, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-dimethylphenyl] carbonate is sourced from PubChem (CID 10325443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).