C14H25NO2 — CID 103254568
methyl 4-[(3,5-dimethylcyclohexyl)amino]-2-methylbut-2-enoate (PubChem CID 103254568) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is methyl 4-[(3,5-dimethylcyclohexyl)amino]-2-methylbut-2-enoate.
| Compound Name | methyl 4-[(3,5-dimethylcyclohexyl)amino]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 103254568 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | methyl 4-[(3,5-dimethylcyclohexyl)amino]-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCNC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H25NO2/c1-10-7-11(2)9-13(8-10)15-6-5-12(3)14(16)17-4/h5,10-11,13,15H,6-9H2,1-4H3 |
| InChIKey | FTIJIHMAGBFVKA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|