C14H25NO3 — CID 103254958
5-[[(2-methylcycloheptyl)amino]methyl]oxolane-2-carboxylic acid (PubChem CID 103254958) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 5-[[(2-methylcycloheptyl)amino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[(2-methylcycloheptyl)amino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 103254958 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 5-[[(2-methylcycloheptyl)amino]methyl]oxolane-2-carboxylic acid |
| SMILES | CC1CCCCCC1NCC1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C14H25NO3/c1-10-5-3-2-4-6-12(10)15-9-11-7-8-13(18-11)14(16)17/h10-13,15H,2-9H2,1H3,(H,16,17) |
| InChIKey | AVSPUQLEXFZCTR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |