C10H17NO3 — CID 103255182
2-[[(2-hydroxycyclopentyl)methylamino]methyl]prop-2-enoic acid (PubChem CID 103255182) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[[(2-hydroxycyclopentyl)methylamino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[(2-hydroxycyclopentyl)methylamino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103255182 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-[[(2-hydroxycyclopentyl)methylamino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNCC1CCCC1O)C(=O)O |
| InChI | InChI=1S/C10H17NO3/c1-7(10(13)14)5-11-6-8-3-2-4-9(8)12/h8-9,11-12H,1-6H2,(H,13,14) |
| InChIKey | UBHNPVPSMJVRCR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|