About 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine
3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine (PubChem CID 10325529) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine.
Molecular Properties
| Compound Name | 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine |
| PubChem CID | 10325529 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine |
| SMILES | CO/N=C1C(=N\OC)/C(c2ccccc2)Oc2ccccc2/1 |
| InChI | InChI=1S/C17H16N2O3/c1-20-18-15-13-10-6-7-11-14(13)22-17(16(15)19-21-2)12-8-4-3-5-9-12/h3-11,17H,1-2H3/b18-15+,19-16+ |
| InChIKey | OLNFEHMYEWRINC-GTLAIDDRSA-N |
| XLogP | 3.17 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine?
The IUPAC name of 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine (CID 10325529) is 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine.
What is the SMILES notation for 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine?
The canonical SMILES for 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine is CO/N=C1C(=N\OC)/C(c2ccccc2)Oc2ccccc2/1.
What is the InChIKey of 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine?
The InChIKey is OLNFEHMYEWRINC-GTLAIDDRSA-N. The full InChI is InChI=1S/C17H16N2O3/c1-20-18-15-13-10-6-7-11-14(13)22-17(16(15)19-21-2)12-8-4-3-5-9-12/h3-11,17H,1-2H3/b18-15+,19-16+.
What are the key properties of 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine?
3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine has a molecular weight of 296.33 g/mol, XLogP of 3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,4-N-dimethoxy-2-phenylchromene-3,4-diimine is sourced from PubChem (CID 10325529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).