C11H23NO4 — CID 103255975
methyl 2-[(2,3-dihydroxy-2-methylpropyl)amino]hexanoate (PubChem CID 103255975) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl 2-[(2,3-dihydroxy-2-methylpropyl)amino]hexanoate.
| Compound Name | methyl 2-[(2,3-dihydroxy-2-methylpropyl)amino]hexanoate |
|---|---|
| PubChem CID | 103255975 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | methyl 2-[(2,3-dihydroxy-2-methylpropyl)amino]hexanoate |
| SMILES | CCCCC(NCC(C)(O)CO)C(=O)OC |
| InChI | InChI=1S/C11H23NO4/c1-4-5-6-9(10(14)16-3)12-7-11(2,15)8-13/h9,12-13,15H,4-8H2,1-3H3 |
| InChIKey | OIVYLQSIMZTDHF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |