C11H17N3O4S — CID 103256249
4-[[(2-methyl-2-methylsulfonylpropyl)amino]methyl]pyrimidine-5-carboxylic acid (PubChem CID 103256249) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-[[(2-methyl-2-methylsulfonylpropyl)amino]methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[[(2-methyl-2-methylsulfonylpropyl)amino]methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103256249 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-[[(2-methyl-2-methylsulfonylpropyl)amino]methyl]pyrimidine-5-carboxylic acid |
| SMILES | CC(C)(CNCc1ncncc1C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C11H17N3O4S/c1-11(2,19(3,17)18)6-12-5-9-8(10(15)16)4-13-7-14-9/h4,7,12H,5-6H2,1-3H3,(H,15,16) |
| InChIKey | PGYLCEKDGIPLNZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |