C14H18BrNO2 — CID 103257361
(Z)-4-[[(1S)-1-(3-bromophenyl)ethyl]amino]-2-ethylbut-2-enoic acid (PubChem CID 103257361) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is (Z)-4-[[(1S)-1-(3-bromophenyl)ethyl]amino]-2-ethylbut-2-enoic acid.
| Compound Name | (Z)-4-[[(1S)-1-(3-bromophenyl)ethyl]amino]-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103257361 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (Z)-4-[[(1S)-1-(3-bromophenyl)ethyl]amino]-2-ethylbut-2-enoic acid |
| SMILES | CC/C(=C/CN[C@@H](C)c1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C14H18BrNO2/c1-3-11(14(17)18)7-8-16-10(2)12-5-4-6-13(15)9-12/h4-7,9-10,16H,3,8H2,1-2H3,(H,17,18)/b11-7-/t10-/m0/s1 |
| InChIKey | JALYMAOVMGZCFK-QBQSQJOESA-N |
| XLogP | 3.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|