C14H23NO3S — CID 103257584
ethyl 3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoate (PubChem CID 103257584) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoate.
| Compound Name | ethyl 3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoate |
|---|---|
| PubChem CID | 103257584 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | ethyl 3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoate |
| SMILES | CCOC(=O)CC(O)CNCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C14H23NO3S/c1-4-18-13(17)8-11(16)9-15-10-14(2,3)12-6-5-7-19-12/h5-7,11,15-16H,4,8-10H2,1-3H3 |
| InChIKey | KXNWBIDNXIKVMO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |