C12H19NO3S — CID 103257619
3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoic acid (PubChem CID 103257619) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoic acid.
| Compound Name | 3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoic acid |
|---|---|
| PubChem CID | 103257619 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-hydroxy-4-[(2-methyl-2-thiophen-2-ylpropyl)amino]butanoic acid |
| SMILES | CC(C)(CNCC(O)CC(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H19NO3S/c1-12(2,10-4-3-5-17-10)8-13-7-9(14)6-11(15)16/h3-5,9,13-14H,6-8H2,1-2H3,(H,15,16) |
| InChIKey | NYFCBVNSMGOVHB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |