C11H15NO2S — CID 103257847
2-cyclopropyl-2-[[(1R)-1-thiophen-2-ylethyl]amino]acetic acid (PubChem CID 103257847) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-cyclopropyl-2-[[(1R)-1-thiophen-2-ylethyl]amino]acetic acid.
| Compound Name | 2-cyclopropyl-2-[[(1R)-1-thiophen-2-ylethyl]amino]acetic acid |
|---|---|
| PubChem CID | 103257847 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-cyclopropyl-2-[[(1R)-1-thiophen-2-ylethyl]amino]acetic acid |
| SMILES | C[C@@H](NC(C(=O)O)C1CC1)c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-7(9-3-2-6-15-9)12-10(11(13)14)8-4-5-8/h2-3,6-8,10,12H,4-5H2,1H3,(H,13,14)/t7-,10?/m1/s1 |
| InChIKey | PFFQOAPUVALBRL-PVSHWOEXSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |