C15H17NO3S — CID 103258542
5-[[[(1R)-1-(4-methoxyphenyl)ethyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 103258542) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 5-[[[(1R)-1-(4-methoxyphenyl)ethyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[[(1R)-1-(4-methoxyphenyl)ethyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103258542 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-[[[(1R)-1-(4-methoxyphenyl)ethyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | COc1ccc([C@@H](C)NCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C15H17NO3S/c1-10(11-3-5-12(19-2)6-4-11)16-9-13-7-8-14(20-13)15(17)18/h3-8,10,16H,9H2,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | HQRQNHDYVAHAOQ-SNVBAGLBSA-N |
| XLogP | 3.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |