C16H19NO4 — CID 103258552
5-[1-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]ethyl]furan-2-carboxylic acid (PubChem CID 103258552) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-[1-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103258552 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 5-[1-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]ethyl]furan-2-carboxylic acid |
| SMILES | COc1ccc([C@@H](C)NC(C)c2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C16H19NO4/c1-10(12-4-6-13(20-3)7-5-12)17-11(2)14-8-9-15(21-14)16(18)19/h4-11,17H,1-3H3,(H,18,19)/t10-,11?/m1/s1 |
| InChIKey | HIHVCKBFUFDWPP-NFJWQWPMSA-N |
| XLogP | 3.40 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |