C11H16N2O3 — CID 103258978
3-hydroxy-4-[[(1R)-1-pyridin-4-ylethyl]amino]butanoic acid (PubChem CID 103258978) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-hydroxy-4-[[(1R)-1-pyridin-4-ylethyl]amino]butanoic acid.
| Compound Name | 3-hydroxy-4-[[(1R)-1-pyridin-4-ylethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 103258978 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-hydroxy-4-[[(1R)-1-pyridin-4-ylethyl]amino]butanoic acid |
| SMILES | C[C@@H](NCC(O)CC(=O)O)c1ccncc1 |
| InChI | InChI=1S/C11H16N2O3/c1-8(9-2-4-12-5-3-9)13-7-10(14)6-11(15)16/h2-5,8,10,13-14H,6-7H2,1H3,(H,15,16)/t8-,10?/m1/s1 |
| InChIKey | IUPVLZHJRUUPCQ-HNHGDDPOSA-N |
| XLogP | 0.57 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |