C10H19NO3 — CID 103259034
(Z)-4-(5-hydroxypentan-2-ylamino)-2-methylbut-2-enoic acid (PubChem CID 103259034) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (Z)-4-(5-hydroxypentan-2-ylamino)-2-methylbut-2-enoic acid.
| Compound Name | (Z)-4-(5-hydroxypentan-2-ylamino)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103259034 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (Z)-4-(5-hydroxypentan-2-ylamino)-2-methylbut-2-enoic acid |
| SMILES | C/C(=C/CNC(C)CCCO)C(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-8(10(13)14)5-6-11-9(2)4-3-7-12/h5,9,11-12H,3-4,6-7H2,1-2H3,(H,13,14)/b8-5- |
| InChIKey | CRNSALQPKYRRLQ-YVMONPNESA-N |
| XLogP | 0.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|