C35H45N3O5 — CID 10326035
4-[6-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]hexoxy]benzamide (PubChem CID 10326035) has the molecular formula C35H45N3O5 and a molecular weight of 587.76 g/mol. Its IUPAC name is 4-[6-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]hexoxy]benzamide.
| Compound Name | 4-[6-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]hexoxy]benzamide |
|---|---|
| PubChem CID | 10326035 |
| Molecular Formula | C35H45N3O5 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | 4-[6-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]hexoxy]benzamide |
| SMILES | COc1ccc(C2=NN(C3CCCCCC3)C(=O)C3CC=CCC23)cc1OCCCCCCOc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C35H45N3O5/c1-41-31-21-18-26(24-32(31)43-23-11-5-4-10-22-42-28-19-16-25(17-20-28)34(36)39)33-29-14-8-9-15-30(29)35(40)38(37-33)27-12-6-2-3-7-13-27/h8-9,16-21,24,27,29-30H,2-7,10-15,22-23H2,1H3,(H2,36,39) |
| InChIKey | HRXLYMCUTJFRLZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|