C8H13F2NO2 — CID 103260414
methyl 2-cyclopropyl-2-(2,2-difluoroethylamino)acetate (PubChem CID 103260414) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is methyl 2-cyclopropyl-2-(2,2-difluoroethylamino)acetate.
| Compound Name | methyl 2-cyclopropyl-2-(2,2-difluoroethylamino)acetate |
|---|---|
| PubChem CID | 103260414 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | methyl 2-cyclopropyl-2-(2,2-difluoroethylamino)acetate |
| SMILES | COC(=O)C(NCC(F)F)C1CC1 |
| InChI | InChI=1S/C8H13F2NO2/c1-13-8(12)7(5-2-3-5)11-4-6(9)10/h5-7,11H,2-4H2,1H3 |
| InChIKey | KTJZPCFGHDRKSR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |