C37H48F2N2O2 — CID 10326089
1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one (PubChem CID 10326089) has the molecular formula C37H48F2N2O2 and a molecular weight of 590.80 g/mol. Its IUPAC name is 1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one.
| Compound Name | 1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one |
|---|---|
| PubChem CID | 10326089 |
| Molecular Formula | C37H48F2N2O2 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | 1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]piperazin-1-yl]-6,6-bis(4-fluorophenyl)hexan-1-one |
| SMILES | CC(C)(C)c1cc(CN2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C37H48F2N2O2/c1-36(2,3)32-23-26(24-33(35(32)43)37(4,5)6)25-40-19-21-41(22-20-40)34(42)10-8-7-9-31(27-11-15-29(38)16-12-27)28-13-17-30(39)18-14-28/h11-18,23-24,31,43H,7-10,19-22,25H2,1-6H3 |
| InChIKey | KAXARLDIZPGNAE-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|