C8H16N2O2 — CID 103261017
ethyl 2-[(2,2-dimethylhydrazinyl)methyl]prop-2-enoate (PubChem CID 103261017) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is ethyl 2-[(2,2-dimethylhydrazinyl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(2,2-dimethylhydrazinyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103261017 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | ethyl 2-[(2,2-dimethylhydrazinyl)methyl]prop-2-enoate |
| SMILES | C=C(CNN(C)C)C(=O)OCC |
| InChI | InChI=1S/C8H16N2O2/c1-5-12-8(11)7(2)6-9-10(3)4/h9H,2,5-6H2,1,3-4H3 |
| InChIKey | VYHOQUKBYSTSAR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|