C33H33N7O4 — CID 10326105
N-[3-(dimethylamino)propyl]-4-[[2-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-1-methylpyrrole-2-carboxamide (PubChem CID 10326105) has the molecular formula C33H33N7O4 and a molecular weight of 591.67 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[[2-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[[2-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 10326105 |
| Molecular Formula | C33H33N7O4 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[[2-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]acetyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)Cn2cc(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c3ccccc32)cn1C |
| InChI | InChI=1S/C33H33N7O4/c1-38(2)14-8-13-34-31(42)27-15-20(17-39(27)3)36-28(41)19-40-18-24(22-10-5-7-12-26(22)40)30-29(32(43)37-33(30)44)23-16-35-25-11-6-4-9-21(23)25/h4-7,9-12,15-18,35H,8,13-14,19H2,1-3H3,(H,34,42)(H,36,41)(H,37,43,44) |
| InChIKey | XEHLOWUQJDBYNM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|