C13H19NO5 — CID 103261463
4-[2-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]ethoxy]benzoic acid (PubChem CID 103261463) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[2-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]ethoxy]benzoic acid.
| Compound Name | 4-[2-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 103261463 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[2-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]ethoxy]benzoic acid |
| SMILES | CC(CO)(CO)NCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO5/c1-13(8-15,9-16)14-6-7-19-11-4-2-10(3-5-11)12(17)18/h2-5,14-16H,6-9H2,1H3,(H,17,18) |
| InChIKey | GVESQRSUWUOWPI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|